C26H26ClN3O4S2 — CID 54248895
1-[[4-[3-[benzoyl(sulfino)amino]thiophen-2-yl]phenyl]methyl]-2-butyl-4-chloro-5-(hydroxymethyl)imidazole (PubChem CID 54248895) has the molecular formula C26H26ClN3O4S2 and a molecular weight of 544.10 g/mol. Its IUPAC name is 1-[[4-[3-[benzoyl(sulfino)amino]thiophen-2-yl]phenyl]methyl]-2-butyl-4-chloro-5-(hydroxymethyl)imidazole.
| Compound Name | 1-[[4-[3-[benzoyl(sulfino)amino]thiophen-2-yl]phenyl]methyl]-2-butyl-4-chloro-5-(hydroxymethyl)imidazole |
|---|---|
| PubChem CID | 54248895 |
| Molecular Formula | C26H26ClN3O4S2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 1-[[4-[3-[benzoyl(sulfino)amino]thiophen-2-yl]phenyl]methyl]-2-butyl-4-chloro-5-(hydroxymethyl)imidazole |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2sccc2N(C(=O)c2ccccc2)S(=O)O)cc1 |
| InChI | InChI=1S/C26H26ClN3O4S2/c1-2-3-9-23-28-25(27)22(17-31)29(23)16-18-10-12-19(13-11-18)24-21(14-15-35-24)30(36(33)34)26(32)20-7-5-4-6-8-20/h4-8,10-15,31H,2-3,9,16-17H2,1H3,(H,33,34) |
| InChIKey | KRYZGBDJCQALHE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|