C29H28N6O3S — CID 54554604
9-[[4-[3-[benzoyl(sulfino)amino]-4-pyridinyl]phenyl]methyl]-2,6-dimethyl-8-propylpurine (PubChem CID 54554604) has the molecular formula C29H28N6O3S and a molecular weight of 540.65 g/mol. Its IUPAC name is 9-[[4-[3-[benzoyl(sulfino)amino]-4-pyridinyl]phenyl]methyl]-2,6-dimethyl-8-propylpurine.
| Compound Name | 9-[[4-[3-[benzoyl(sulfino)amino]-4-pyridinyl]phenyl]methyl]-2,6-dimethyl-8-propylpurine |
|---|---|
| PubChem CID | 54554604 |
| Molecular Formula | C29H28N6O3S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 9-[[4-[3-[benzoyl(sulfino)amino]-4-pyridinyl]phenyl]methyl]-2,6-dimethyl-8-propylpurine |
| SMILES | CCCc1nc2c(C)nc(C)nc2n1Cc1ccc(-c2ccncc2N(C(=O)c2ccccc2)S(=O)O)cc1 |
| InChI | InChI=1S/C29H28N6O3S/c1-4-8-26-33-27-19(2)31-20(3)32-28(27)34(26)18-21-11-13-22(14-12-21)24-15-16-30-17-25(24)35(39(37)38)29(36)23-9-6-5-7-10-23/h5-7,9-17H,4,8,18H2,1-3H3,(H,37,38) |
| InChIKey | JXTQOFVIUPXPOB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|