C27H23N3O3 — CID 11975311
1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-oxoindene-2-carboxylic acid (PubChem CID 11975311) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-oxoindene-2-carboxylic acid.
| Compound Name | 1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-oxoindene-2-carboxylic acid |
|---|---|
| PubChem CID | 11975311 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-oxoindene-2-carboxylic acid |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(C2=C(C(=O)O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H23N3O3/c1-4-21-29-24-15(2)13-16(3)28-26(24)30(21)14-17-9-11-18(12-10-17)22-19-7-5-6-8-20(19)25(31)23(22)27(32)33/h5-13H,4,14H2,1-3H3,(H,32,33) |
| InChIKey | KPIIGJRYOLMSAK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|