C41H37ClN6O — CID 59738382
[5-chloro-2-(1,2,2,3,3,4,4,4-octadeuteriobutyl)-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-dideuteriomethanol (PubChem CID 59738382) has the molecular formula C41H37ClN6O and a molecular weight of 675.30 g/mol. Its IUPAC name is [5-chloro-2-(1,2,2,3,3,4,4,4-octadeuteriobutyl)-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-dideuteriomethanol.
| Compound Name | [5-chloro-2-(1,2,2,3,3,4,4,4-octadeuteriobutyl)-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-dideuteriomethanol |
|---|---|
| PubChem CID | 59738382 |
| Molecular Formula | C41H37ClN6O |
| Molecular Weight | 675.30 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | [5-chloro-2-(1,2,2,3,3,4,4,4-octadeuteriobutyl)-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-dideuteriomethanol |
| SMILES | [2H]C(c1nc(Cl)c(C([2H])([2H])O)n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C41H37ClN6O/c1-2-3-23-38-43-39(42)37(29-49)47(38)28-30-24-26-31(27-25-30)35-21-13-14-22-36(35)40-44-46-48(45-40)41(32-15-7-4-8-16-32,33-17-9-5-10-18-33)34-19-11-6-12-20-34/h4-22,24-27,49H,2-3,23,28-29H2,1H3/i1D3,2D2,3D2,23D,29D2 |
| InChIKey | QQPGGBNMTNDKEY-ZCMKCFHFSA-N |
| XLogP | 8.58 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.30 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|