C47H41N7O2 — CID 139665701
ethyl 2-[propyl-[[2-[2-(2-trityltetrazol-5-yl)phenyl]quinolin-6-yl]methyl]amino]pyridine-3-carboxylate (PubChem CID 139665701) has the molecular formula C47H41N7O2 and a molecular weight of 735.89 g/mol. Its IUPAC name is ethyl 2-[propyl-[[2-[2-(2-trityltetrazol-5-yl)phenyl]quinolin-6-yl]methyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[propyl-[[2-[2-(2-trityltetrazol-5-yl)phenyl]quinolin-6-yl]methyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139665701 |
| Molecular Formula | C47H41N7O2 |
| Molecular Weight | 735.89 g/mol |
| Exact Mass | 735.33 |
| IUPAC Name | ethyl 2-[propyl-[[2-[2-(2-trityltetrazol-5-yl)phenyl]quinolin-6-yl]methyl]amino]pyridine-3-carboxylate |
| SMILES | CCCN(Cc1ccc2nc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)ccc2c1)c1ncccc1C(=O)OCC |
| InChI | InChI=1S/C47H41N7O2/c1-3-31-53(45-41(25-16-30-48-45)46(55)56-4-2)33-34-26-28-42-35(32-34)27-29-43(49-42)39-23-14-15-24-40(39)44-50-52-54(51-44)47(36-17-8-5-9-18-36,37-19-10-6-11-20-37)38-21-12-7-13-22-38/h5-30,32H,3-4,31,33H2,1-2H3 |
| InChIKey | CCWRFAVSQMEUCD-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.89 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|