C42H43N5O2 — CID 58810554
tert-butyl (2S)-3-methyl-2-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methylamino]butanoate (PubChem CID 58810554) has the molecular formula C42H43N5O2 and a molecular weight of 649.84 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methylamino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 58810554 |
| Molecular Formula | C42H43N5O2 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methylamino]butanoate |
| SMILES | CC(C)[C@H](NCc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H43N5O2/c1-30(2)38(40(48)49-41(3,4)5)43-29-31-25-27-32(28-26-31)36-23-15-16-24-37(36)39-44-46-47(45-39)42(33-17-9-6-10-18-33,34-19-11-7-12-20-34)35-21-13-8-14-22-35/h6-28,30,38,43H,29H2,1-5H3/t38-/m0/s1 |
| InChIKey | AJGYQFPBUNAFOB-LHEWISCISA-N |
| XLogP | 8.30 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|