C33H33N5O2 — CID 118268344
benzyl (2S)-2-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methylamino]-3-methylbutanoate (PubChem CID 118268344) has the molecular formula C33H33N5O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methylamino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118268344 |
| Molecular Formula | C33H33N5O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | benzyl (2S)-2-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NCc1ccc(-c2ccccc2-c2nnnn2Cc2ccccc2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H33N5O2/c1-24(2)31(33(39)40-23-27-13-7-4-8-14-27)34-21-25-17-19-28(20-18-25)29-15-9-10-16-30(29)32-35-36-37-38(32)22-26-11-5-3-6-12-26/h3-20,24,31,34H,21-23H2,1-2H3/t31-/m0/s1 |
| InChIKey | PUMGGLYCHVXGRR-HKBQPEDESA-N |
| XLogP | 5.91 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |