C26H27N5O2 — CID 91607272
benzyl (2S)-3-methyl-2-[[4-phenyl-3-(tetrazol-2-yl)phenyl]methylamino]butanoate (PubChem CID 91607272) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[4-phenyl-3-(tetrazol-2-yl)phenyl]methylamino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[4-phenyl-3-(tetrazol-2-yl)phenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 91607272 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[4-phenyl-3-(tetrazol-2-yl)phenyl]methylamino]butanoate |
| SMILES | CC(C)[C@H](NCc1ccc(-c2ccccc2)c(-n2ncnn2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27N5O2/c1-19(2)25(26(32)33-17-20-9-5-3-6-10-20)27-16-21-13-14-23(22-11-7-4-8-12-22)24(15-21)31-29-18-28-30-31/h3-15,18-19,25,27H,16-17H2,1-2H3/t25-/m0/s1 |
| InChIKey | MFPQSVQNUQFLFY-VWLOTQADSA-N |
| XLogP | 4.19 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |