C50H48N2O8 — CID 155093736
dibenzyl 2-[[3-[3-[[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]methyl]phenyl]phenyl]methylamino]butanedioate (PubChem CID 155093736) has the molecular formula C50H48N2O8 and a molecular weight of 804.94 g/mol. Its IUPAC name is dibenzyl 2-[[3-[3-[[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]methyl]phenyl]phenyl]methylamino]butanedioate.
| Compound Name | dibenzyl 2-[[3-[3-[[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]methyl]phenyl]phenyl]methylamino]butanedioate |
|---|---|
| PubChem CID | 155093736 |
| Molecular Formula | C50H48N2O8 |
| Molecular Weight | 804.94 g/mol |
| Exact Mass | 804.34 |
| IUPAC Name | dibenzyl 2-[[3-[3-[[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]methyl]phenyl]phenyl]methylamino]butanedioate |
| SMILES | O=C(CC(NCc1cccc(-c2cccc(CNC(CC(=O)OCc3ccccc3)C(=O)OCc3ccccc3)c2)c1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C50H48N2O8/c53-47(57-33-37-15-5-1-6-16-37)29-45(49(55)59-35-39-19-9-3-10-20-39)51-31-41-23-13-25-43(27-41)44-26-14-24-42(28-44)32-52-46(50(56)60-36-40-21-11-4-12-22-40)30-48(54)58-34-38-17-7-2-8-18-38/h1-28,45-46,51-52H,29-36H2 |
| InChIKey | VLYZRIRTQGZGCA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.94 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|