C24H36N2O8 — CID 90442136
diethyl 2-[[3-[[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]methyl]phenyl]methylamino]butanedioate (PubChem CID 90442136) has the molecular formula C24H36N2O8 and a molecular weight of 480.56 g/mol. Its IUPAC name is diethyl 2-[[3-[[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]methyl]phenyl]methylamino]butanedioate.
| Compound Name | diethyl 2-[[3-[[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]methyl]phenyl]methylamino]butanedioate |
|---|---|
| PubChem CID | 90442136 |
| Molecular Formula | C24H36N2O8 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | diethyl 2-[[3-[[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]methyl]phenyl]methylamino]butanedioate |
| SMILES | CCOC(=O)CC(NCc1cccc(CNC(CC(=O)OCC)C(=O)OCC)c1)C(=O)OCC |
| InChI | InChI=1S/C24H36N2O8/c1-5-31-21(27)13-19(23(29)33-7-3)25-15-17-10-9-11-18(12-17)16-26-20(24(30)34-8-4)14-22(28)32-6-2/h9-12,19-20,25-26H,5-8,13-16H2,1-4H3 |
| InChIKey | SPVLXHGCFQGKFQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|