C16H24N2O4 — CID 85049917
diethyl 2-[(4-aminophenyl)methylamino]pentanedioate (PubChem CID 85049917) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is diethyl 2-[(4-aminophenyl)methylamino]pentanedioate.
| Compound Name | diethyl 2-[(4-aminophenyl)methylamino]pentanedioate |
|---|---|
| PubChem CID | 85049917 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | diethyl 2-[(4-aminophenyl)methylamino]pentanedioate |
| SMILES | CCOC(=O)CCC(NCc1ccc(N)cc1)C(=O)OCC |
| InChI | InChI=1S/C16H24N2O4/c1-3-21-15(19)10-9-14(16(20)22-4-2)18-11-12-5-7-13(17)8-6-12/h5-8,14,18H,3-4,9-11,17H2,1-2H3 |
| InChIKey | QNOWIDQFZCZYLS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|