C22H27NO4 — CID 146569172
benzyl (2S)-3-methyl-2-[[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]butanoate (PubChem CID 146569172) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]butanoate |
|---|---|
| PubChem CID | 146569172 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]butanoate |
| SMILES | Cc1ccc(COC(=O)CN[C@H](C(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-16(2)21(22(25)27-15-18-7-5-4-6-8-18)23-13-20(24)26-14-19-11-9-17(3)10-12-19/h4-12,16,21,23H,13-15H2,1-3H3/t21-/m0/s1 |
| InChIKey | HBNOBEGLQXMHLR-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |