C18H26N2O5 — CID 22859676
benzyl (2S)-2-[[(2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-methylbutanoyl]amino]propanoate (PubChem CID 22859676) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-methylbutanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-methylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 22859676 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-methylbutanoyl]amino]propanoate |
| SMILES | COC(=O)CN[C@H](C(=O)N[C@@H](C)C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H26N2O5/c1-12(2)16(19-10-15(21)24-4)17(22)20-13(3)18(23)25-11-14-8-6-5-7-9-14/h5-9,12-13,16,19H,10-11H2,1-4H3,(H,20,22)/t13-,16-/m0/s1 |
| InChIKey | VCDNPRNHFLOOGA-BBRMVZONSA-N |
| XLogP | 1.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |