C24H28BrNO5 — CID 153488908
benzyl (2S)-2-[(2-bromoacetyl)-[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]-3-methylbutanoate (PubChem CID 153488908) has the molecular formula C24H28BrNO5 and a molecular weight of 490.39 g/mol. Its IUPAC name is benzyl (2S)-2-[(2-bromoacetyl)-[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[(2-bromoacetyl)-[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 153488908 |
| Molecular Formula | C24H28BrNO5 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | benzyl (2S)-2-[(2-bromoacetyl)-[2-[(4-methylphenyl)methoxy]-2-oxoethyl]amino]-3-methylbutanoate |
| SMILES | Cc1ccc(COC(=O)CN(C(=O)CBr)[C@H](C(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H28BrNO5/c1-17(2)23(24(29)31-16-19-7-5-4-6-8-19)26(21(27)13-25)14-22(28)30-15-20-11-9-18(3)10-12-20/h4-12,17,23H,13-16H2,1-3H3/t23-/m0/s1 |
| InChIKey | FHJXDVFGKPRMOC-QHCPKHFHSA-N |
| XLogP | 4.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|