C31H35ClN2O3 — CID 87407188
benzyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;pentanoyl chloride (PubChem CID 87407188) has the molecular formula C31H35ClN2O3 and a molecular weight of 519.09 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;pentanoyl chloride.
| Compound Name | benzyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;pentanoyl chloride |
|---|---|
| PubChem CID | 87407188 |
| Molecular Formula | C31H35ClN2O3 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | benzyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;pentanoyl chloride |
| SMILES | CC(C)[C@H](NCc1ccc(-c2ccccc2C#N)cc1)C(=O)OCc1ccccc1.CCCCC(=O)Cl |
| InChI | InChI=1S/C26H26N2O2.C5H9ClO/c1-19(2)25(26(29)30-18-21-8-4-3-5-9-21)28-17-20-12-14-22(15-13-20)24-11-7-6-10-23(24)16-27;1-2-3-4-5(6)7/h3-15,19,25,28H,17-18H2,1-2H3;2-4H2,1H3/t25-;/m0./s1 |
| InChIKey | XJBKBZYOEMXMJI-UQIIZPHYSA-N |
| XLogP | 7.02 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|