C23H25NO3 — CID 10384107
2-[4-[2-(2-methoxyacetyl)-3-oxoheptyl]phenyl]benzonitrile (PubChem CID 10384107) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[4-[2-(2-methoxyacetyl)-3-oxoheptyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[2-(2-methoxyacetyl)-3-oxoheptyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 10384107 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[4-[2-(2-methoxyacetyl)-3-oxoheptyl]phenyl]benzonitrile |
| SMILES | CCCCC(=O)C(Cc1ccc(-c2ccccc2C#N)cc1)C(=O)COC |
| InChI | InChI=1S/C23H25NO3/c1-3-4-9-22(25)21(23(26)16-27-2)14-17-10-12-18(13-11-17)20-8-6-5-7-19(20)15-24/h5-8,10-13,21H,3-4,9,14,16H2,1-2H3 |
| InChIKey | MNZRBYGTIVFPIP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|