C21H22N2O — CID 143886533
2-[4-[(Z)-3-amino-2-formylhept-2-enyl]phenyl]benzonitrile (PubChem CID 143886533) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[4-[(Z)-3-amino-2-formylhept-2-enyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(Z)-3-amino-2-formylhept-2-enyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 143886533 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[4-[(Z)-3-amino-2-formylhept-2-enyl]phenyl]benzonitrile |
| SMILES | CCCC/C(N)=C(/C=O)Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-2-3-8-21(23)19(15-24)13-16-9-11-17(12-10-16)20-7-5-4-6-18(20)14-22/h4-7,9-12,15H,2-3,8,13,23H2,1H3/b21-19- |
| InChIKey | KWLHCQJHLCSOCE-VZCXRCSSSA-N |
| XLogP | 4.37 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|