C21H23N3O2 — CID 141295805
methyl 3-amino-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoate (PubChem CID 141295805) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 3-amino-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoate.
| Compound Name | methyl 3-amino-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoate |
|---|---|
| PubChem CID | 141295805 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | methyl 3-amino-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoate |
| SMILES | CCCCC(N)=C(Cc1ccc(-c2ccccc2C#N)cn1)C(=O)OC |
| InChI | InChI=1S/C21H23N3O2/c1-3-4-9-20(23)19(21(25)26-2)12-17-11-10-16(14-24-17)18-8-6-5-7-15(18)13-22/h5-8,10-11,14H,3-4,9,12,23H2,1-2H3 |
| InChIKey | WWINLFDMVNWZSY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|