C22H23N3O3 — CID 67979624
(E)-3-acetamido-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoic acid (PubChem CID 67979624) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (E)-3-acetamido-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoic acid.
| Compound Name | (E)-3-acetamido-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 67979624 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (E)-3-acetamido-2-[[5-(2-cyanophenyl)-2-pyridinyl]methyl]hept-2-enoic acid |
| SMILES | CCCC/C(NC(C)=O)=C(/Cc1ccc(-c2ccccc2C#N)cn1)C(=O)O |
| InChI | InChI=1S/C22H23N3O3/c1-3-4-9-21(25-15(2)26)20(22(27)28)12-18-11-10-17(14-24-18)19-8-6-5-7-16(19)13-23/h5-8,10-11,14H,3-4,9,12H2,1-2H3,(H,25,26)(H,27,28)/b21-20+ |
| InChIKey | ZBQKZHRVTWACPW-QZQOTICOSA-N |
| XLogP | 3.83 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|