C23H25N3O3 — CID 67979340
(Z)-2-[[6-(2-cyanophenyl)-3-pyridinyl]methyl]-3-(propanoylamino)hept-2-enoic acid (PubChem CID 67979340) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (Z)-2-[[6-(2-cyanophenyl)-3-pyridinyl]methyl]-3-(propanoylamino)hept-2-enoic acid.
| Compound Name | (Z)-2-[[6-(2-cyanophenyl)-3-pyridinyl]methyl]-3-(propanoylamino)hept-2-enoic acid |
|---|---|
| PubChem CID | 67979340 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (Z)-2-[[6-(2-cyanophenyl)-3-pyridinyl]methyl]-3-(propanoylamino)hept-2-enoic acid |
| SMILES | CCCC/C(NC(=O)CC)=C(\Cc1ccc(-c2ccccc2C#N)nc1)C(=O)O |
| InChI | InChI=1S/C23H25N3O3/c1-3-5-10-21(26-22(27)4-2)19(23(28)29)13-16-11-12-20(25-15-16)18-9-7-6-8-17(18)14-24/h6-9,11-12,15H,3-5,10,13H2,1-2H3,(H,26,27)(H,28,29)/b21-19- |
| InChIKey | AUJAUYKRLOTRFX-VZCXRCSSSA-N |
| XLogP | 4.22 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|