About 2-phenylbenzonitrile;urea
2-phenylbenzonitrile;urea (PubChem CID 162064762) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-phenylbenzonitrile;urea.
Molecular Properties
| Compound Name | 2-phenylbenzonitrile;urea |
| PubChem CID | 162064762 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-phenylbenzonitrile;urea |
| SMILES | N#Cc1ccccc1-c1ccccc1.NC(N)=O |
| InChI | InChI=1S/C13H9N.CH4N2O/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;2-1(3)4/h1-9H;(H4,2,3,4) |
| InChIKey | ZAHTWRNHZQDNHC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylbenzonitrile;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbenzonitrile;urea?
The IUPAC name of 2-phenylbenzonitrile;urea (CID 162064762) is 2-phenylbenzonitrile;urea.
What is the SMILES notation for 2-phenylbenzonitrile;urea?
The canonical SMILES for 2-phenylbenzonitrile;urea is N#Cc1ccccc1-c1ccccc1.NC(N)=O.
What is the InChIKey of 2-phenylbenzonitrile;urea?
The InChIKey is ZAHTWRNHZQDNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.CH4N2O/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;2-1(3)4/h1-9H;(H4,2,3,4).
What are the key properties of 2-phenylbenzonitrile;urea?
2-phenylbenzonitrile;urea has a molecular weight of 239.28 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbenzonitrile;urea is sourced from PubChem (CID 162064762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).