C21H16N4 — CID 142469905
N-[amino(phenyl)methylidene]-4-(2-cyanophenyl)benzenecarboximidamide (PubChem CID 142469905) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-4-(2-cyanophenyl)benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-4-(2-cyanophenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142469905 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[amino(phenyl)methylidene]-4-(2-cyanophenyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C21H16N4/c22-14-18-8-4-5-9-19(18)15-10-12-17(13-11-15)21(24)25-20(23)16-6-2-1-3-7-16/h1-13H,(H3,23,24,25) |
| InChIKey | KLNQDGUAXZFKGX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|