C42H37N3 — CID 145110773
N-[amino(phenyl)methylidene]-3-[3-(9,9-dimethylfluoren-2-yl)phenyl]benzenecarboximidamide;toluene (PubChem CID 145110773) has the molecular formula C42H37N3 and a molecular weight of 583.78 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-3-[3-(9,9-dimethylfluoren-2-yl)phenyl]benzenecarboximidamide;toluene.
| Compound Name | N-[amino(phenyl)methylidene]-3-[3-(9,9-dimethylfluoren-2-yl)phenyl]benzenecarboximidamide;toluene |
|---|---|
| PubChem CID | 145110773 |
| Molecular Formula | C42H37N3 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | N-[amino(phenyl)methylidene]-3-[3-(9,9-dimethylfluoren-2-yl)phenyl]benzenecarboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\N=C(/N)c1ccccc1)c1cccc(-c2cccc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)c1 |
| InChI | InChI=1S/C35H29N3.C7H8/c1-35(2)31-17-7-6-16-29(31)30-19-18-27(22-32(30)35)25-13-8-12-24(20-25)26-14-9-15-28(21-26)34(37)38-33(36)23-10-4-3-5-11-23;1-7-5-3-2-4-6-7/h3-22H,1-2H3,(H3,36,37,38);2-6H,1H3 |
| InChIKey | YQUCHMWRWKOXIC-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|