C53H40N2 — CID 176835010
N-[(E)-3-[4-(9,9-dimethylfluoren-4-yl)naphthalen-1-yl]-1-(3,5-diphenylphenyl)prop-2-enylidene]benzenecarboximidamide (PubChem CID 176835010) has the molecular formula C53H40N2 and a molecular weight of 704.92 g/mol. Its IUPAC name is N-[(E)-3-[4-(9,9-dimethylfluoren-4-yl)naphthalen-1-yl]-1-(3,5-diphenylphenyl)prop-2-enylidene]benzenecarboximidamide.
| Compound Name | N-[(E)-3-[4-(9,9-dimethylfluoren-4-yl)naphthalen-1-yl]-1-(3,5-diphenylphenyl)prop-2-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 176835010 |
| Molecular Formula | C53H40N2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | N-[(E)-3-[4-(9,9-dimethylfluoren-4-yl)naphthalen-1-yl]-1-(3,5-diphenylphenyl)prop-2-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/C=C/c1ccc(-c2cccc3c2-c2ccccc2C3(C)C)c2ccccc12)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C53H40N2/c1-53(2)48-27-15-14-25-47(48)51-46(26-16-28-49(51)53)45-31-29-38(43-23-12-13-24-44(43)45)30-32-50(55-52(54)39-21-10-5-11-22-39)42-34-40(36-17-6-3-7-18-36)33-41(35-42)37-19-8-4-9-20-37/h3-35,54H,1-2H3/b32-30+,54-52+,55-50- |
| InChIKey | TVBBYUYCECLTKT-VJENRTOXSA-N |
| XLogP | 13.68 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|