C60H43N3 — CID 176834690
N-[(E)-3-[4-[4-(7,7-dimethylbenzo[c]fluoren-10-yl)naphthalen-1-yl]naphthalen-1-yl]-1-(3-pyridin-3-ylphenyl)prop-2-enylidene]benzenecarboximidamide (PubChem CID 176834690) has the molecular formula C60H43N3 and a molecular weight of 806.03 g/mol. Its IUPAC name is N-[(E)-3-[4-[4-(7,7-dimethylbenzo[c]fluoren-10-yl)naphthalen-1-yl]naphthalen-1-yl]-1-(3-pyridin-3-ylphenyl)prop-2-enylidene]benzenecarboximidamide.
| Compound Name | N-[(E)-3-[4-[4-(7,7-dimethylbenzo[c]fluoren-10-yl)naphthalen-1-yl]naphthalen-1-yl]-1-(3-pyridin-3-ylphenyl)prop-2-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 176834690 |
| Molecular Formula | C60H43N3 |
| Molecular Weight | 806.03 g/mol |
| Exact Mass | 805.35 |
| IUPAC Name | N-[(E)-3-[4-[4-(7,7-dimethylbenzo[c]fluoren-10-yl)naphthalen-1-yl]naphthalen-1-yl]-1-(3-pyridin-3-ylphenyl)prop-2-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/C=C/c1ccc(-c2ccc(-c3ccc4c(c3)-c3c(ccc5ccccc35)C4(C)C)c3ccccc23)c2ccccc12)c1cccc(-c2cccnc2)c1)c1ccccc1 |
| InChI | InChI=1S/C60H43N3/c1-60(2)55-32-27-43(37-54(55)58-48-21-7-6-14-39(48)26-33-56(58)60)47-30-31-53(51-24-11-10-23-50(47)51)52-29-25-40(46-20-8-9-22-49(46)52)28-34-57(63-59(61)41-15-4-3-5-16-41)44-18-12-17-42(36-44)45-19-13-35-62-38-45/h3-38,61H,1-2H3/b34-28+,61-59+,63-57- |
| InChIKey | CQDJEWOLVBWFFA-GLUJOBDCSA-N |
| XLogP | 15.38 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.03 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|