C51H38N2 — CID 176835191
(Z)-N'-[[4-[3-(7,7-dimethylbenzo[c]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1,3-diphenylprop-2-ene-1,3-diimine (PubChem CID 176835191) has the molecular formula C51H38N2 and a molecular weight of 678.88 g/mol. Its IUPAC name is (Z)-N'-[[4-[3-(7,7-dimethylbenzo[c]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1,3-diphenylprop-2-ene-1,3-diimine.
| Compound Name | (Z)-N'-[[4-[3-(7,7-dimethylbenzo[c]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1,3-diphenylprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 176835191 |
| Molecular Formula | C51H38N2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | (Z)-N'-[[4-[3-(7,7-dimethylbenzo[c]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1,3-diphenylprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C\c1ccc(-c2cccc(-c3ccc4c(c3)-c3c(ccc5ccccc35)C4(C)C)c2)c2ccccc12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H38N2/c1-51(2)46-28-26-38(31-45(46)50-43-22-10-9-14-34(43)25-29-47(50)51)37-19-13-20-39(30-37)42-27-24-40(41-21-11-12-23-44(41)42)33-53-49(36-17-7-4-8-18-36)32-48(52)35-15-5-3-6-16-35/h3-33,52H,1-2H3/b49-32-,52-48-,53-33+ |
| InChIKey | JIOQOLSCHNMNFW-NOMHBWMTSA-N |
| XLogP | 13.16 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|