C55H38N2 — CID 176835008
(Z)-N'-[[4-[4-(11H-benzo[a]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1-phenyl-3-(3-phenylphenyl)prop-2-ene-1,3-diimine (PubChem CID 176835008) has the molecular formula C55H38N2 and a molecular weight of 726.92 g/mol. Its IUPAC name is (Z)-N'-[[4-[4-(11H-benzo[a]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1-phenyl-3-(3-phenylphenyl)prop-2-ene-1,3-diimine.
| Compound Name | (Z)-N'-[[4-[4-(11H-benzo[a]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1-phenyl-3-(3-phenylphenyl)prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 176835008 |
| Molecular Formula | C55H38N2 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | (Z)-N'-[[4-[4-(11H-benzo[a]fluoren-10-yl)phenyl]naphthalen-1-yl]methylidene]-1-phenyl-3-(3-phenylphenyl)prop-2-ene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C\c1ccc(-c2ccc(-c3cccc4c3Cc3c-4ccc4ccccc34)cc2)c2ccccc12)c1cccc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C55H38N2/c56-54(41-16-5-2-6-17-41)35-55(43-19-11-18-42(33-43)37-13-3-1-4-14-37)57-36-44-30-31-48(49-22-10-9-21-47(44)49)40-27-25-39(26-28-40)46-23-12-24-50-51-32-29-38-15-7-8-20-45(38)53(51)34-52(46)50/h1-33,35-36,56H,34H2/b55-35-,56-54-,57-36+ |
| InChIKey | VXKXFTQHGGBSLW-DJBWGDPDSA-N |
| XLogP | 14.09 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|