C63H43N3 — CID 134303816
(Z)-1-phenyl-N'-[(4-phenylphenyl)methylidene]-3-[4-(10-phenylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]prop-2-ene-1,3-diimine (PubChem CID 134303816) has the molecular formula C63H43N3 and a molecular weight of 842.06 g/mol. Its IUPAC name is (Z)-1-phenyl-N'-[(4-phenylphenyl)methylidene]-3-[4-(10-phenylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]prop-2-ene-1,3-diimine.
| Compound Name | (Z)-1-phenyl-N'-[(4-phenylphenyl)methylidene]-3-[4-(10-phenylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 134303816 |
| Molecular Formula | C63H43N3 |
| Molecular Weight | 842.06 g/mol |
| Exact Mass | 841.35 |
| IUPAC Name | (Z)-1-phenyl-N'-[(4-phenylphenyl)methylidene]-3-[4-(10-phenylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]prop-2-ene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C\c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccc3c(c2)C2(c4ccccc4N(c4ccccc4)c4ccccc42)c2c-3ccc3ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C63H43N3/c64-58(48-19-6-2-7-20-48)41-59(65-42-43-28-30-45(31-29-43)44-16-4-1-5-17-44)49-34-32-46(33-35-49)50-37-38-53-54-39-36-47-18-10-11-23-52(47)62(54)63(57(53)40-50)55-24-12-14-26-60(55)66(51-21-8-3-9-22-51)61-27-15-13-25-56(61)63/h1-42,64H/b59-41-,64-58-,65-42+ |
| InChIKey | GYAPLGUGCGENKE-MMOUSCQMSA-N |
| XLogP | 15.85 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.06 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|