C64H46N2 — CID 176834811
(Z)-N'-[[4-(11,11-dimethylbenzo[a]fluoren-10-yl)naphthalen-1-yl]methylidene]-3-(9,9-diphenylfluoren-2-yl)-1-phenylprop-2-ene-1,3-diimine (PubChem CID 176834811) has the molecular formula C64H46N2 and a molecular weight of 843.09 g/mol. Its IUPAC name is (Z)-N'-[[4-(11,11-dimethylbenzo[a]fluoren-10-yl)naphthalen-1-yl]methylidene]-3-(9,9-diphenylfluoren-2-yl)-1-phenylprop-2-ene-1,3-diimine.
| Compound Name | (Z)-N'-[[4-(11,11-dimethylbenzo[a]fluoren-10-yl)naphthalen-1-yl]methylidene]-3-(9,9-diphenylfluoren-2-yl)-1-phenylprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 176834811 |
| Molecular Formula | C64H46N2 |
| Molecular Weight | 843.09 g/mol |
| Exact Mass | 842.37 |
| IUPAC Name | (Z)-N'-[[4-(11,11-dimethylbenzo[a]fluoren-10-yl)naphthalen-1-yl]methylidene]-3-(9,9-diphenylfluoren-2-yl)-1-phenylprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C\c1ccc(-c2cccc3c2C(C)(C)c2c-3ccc3ccccc23)c2ccccc12)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C64H46N2/c1-63(2)61-49-27-13-12-19-42(49)33-38-56(61)55-31-18-30-54(62(55)63)51-36-35-45(48-26-14-15-28-50(48)51)41-66-60(40-59(65)43-20-6-3-7-21-43)44-34-37-53-52-29-16-17-32-57(52)64(58(53)39-44,46-22-8-4-9-23-46)47-24-10-5-11-25-47/h3-41,65H,1-2H3/b60-40-,65-59-,66-41+ |
| InChIKey | FVDBNJRJBINXFD-APVJOJFASA-N |
| XLogP | 15.86 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.09 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|