C53H38N2S — CID 171583362
N-[(E)-1-(3-dibenzothiophen-1-yl-5-naphthalen-2-ylphenyl)-3-(9,9-dimethylfluoren-4-yl)prop-2-enylidene]benzenecarboximidamide (PubChem CID 171583362) has the molecular formula C53H38N2S and a molecular weight of 734.97 g/mol. Its IUPAC name is N-[(E)-1-(3-dibenzothiophen-1-yl-5-naphthalen-2-ylphenyl)-3-(9,9-dimethylfluoren-4-yl)prop-2-enylidene]benzenecarboximidamide.
| Compound Name | N-[(E)-1-(3-dibenzothiophen-1-yl-5-naphthalen-2-ylphenyl)-3-(9,9-dimethylfluoren-4-yl)prop-2-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 171583362 |
| Molecular Formula | C53H38N2S |
| Molecular Weight | 734.97 g/mol |
| Exact Mass | 734.28 |
| IUPAC Name | N-[(E)-1-(3-dibenzothiophen-1-yl-5-naphthalen-2-ylphenyl)-3-(9,9-dimethylfluoren-4-yl)prop-2-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/C=C/c1cccc2c1-c1ccccc1C2(C)C)c1cc(-c2ccc3ccccc3c2)cc(-c2cccc3sc4ccccc4c23)c1)c1ccccc1 |
| InChI | InChI=1S/C53H38N2S/c1-53(2)45-22-10-8-19-43(45)50-35(18-12-23-46(50)53)28-29-47(55-52(54)36-15-4-3-5-16-36)41-32-39(38-27-26-34-14-6-7-17-37(34)30-38)31-40(33-41)42-21-13-25-49-51(42)44-20-9-11-24-48(44)56-49/h3-33,54H,1-2H3/b29-28+,54-52+,55-47- |
| InChIKey | QZTDNOMRZRIUSL-GXANXLNGSA-N |
| XLogP | 14.38 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.97 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|