C57H42N2 — CID 176835281
N-[(E)-3-[4-[4-(9,9-dimethylfluoren-1-yl)phenyl]naphthalen-1-yl]-1-(2-naphthalen-2-ylphenyl)prop-2-enylidene]benzenecarboximidamide (PubChem CID 176835281) has the molecular formula C57H42N2 and a molecular weight of 754.98 g/mol. Its IUPAC name is N-[(E)-3-[4-[4-(9,9-dimethylfluoren-1-yl)phenyl]naphthalen-1-yl]-1-(2-naphthalen-2-ylphenyl)prop-2-enylidene]benzenecarboximidamide.
| Compound Name | N-[(E)-3-[4-[4-(9,9-dimethylfluoren-1-yl)phenyl]naphthalen-1-yl]-1-(2-naphthalen-2-ylphenyl)prop-2-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 176835281 |
| Molecular Formula | C57H42N2 |
| Molecular Weight | 754.98 g/mol |
| Exact Mass | 754.33 |
| IUPAC Name | N-[(E)-3-[4-[4-(9,9-dimethylfluoren-1-yl)phenyl]naphthalen-1-yl]-1-(2-naphthalen-2-ylphenyl)prop-2-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\C=C\c1ccc(-c2ccc(-c3cccc4c3C(C)(C)c3ccccc3-4)cc2)c2ccccc12)c1ccccc1-c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C57H42N2/c1-57(2)53-26-13-12-22-50(53)52-25-14-24-48(55(52)57)41-30-28-39(29-31-41)47-35-33-40(45-19-8-10-21-49(45)47)34-36-54(59-56(58)42-16-4-3-5-17-42)51-23-11-9-20-46(51)44-32-27-38-15-6-7-18-43(38)37-44/h3-37,58H,1-2H3/b36-34+,58-56+,59-54+ |
| InChIKey | JQBJAQDRGIQOIW-JKAXWDERSA-N |
| XLogP | 14.83 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.98 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|