C50H34N2S — CID 171583410
N-[(E)-1-[3-dibenzothiophen-1-yl-5-(4-naphthalen-1-ylphenyl)phenyl]-3-phenylprop-2-enylidene]benzenecarboximidamide (PubChem CID 171583410) has the molecular formula C50H34N2S and a molecular weight of 694.90 g/mol. Its IUPAC name is N-[(E)-1-[3-dibenzothiophen-1-yl-5-(4-naphthalen-1-ylphenyl)phenyl]-3-phenylprop-2-enylidene]benzenecarboximidamide.
| Compound Name | N-[(E)-1-[3-dibenzothiophen-1-yl-5-(4-naphthalen-1-ylphenyl)phenyl]-3-phenylprop-2-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 171583410 |
| Molecular Formula | C50H34N2S |
| Molecular Weight | 694.90 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | N-[(E)-1-[3-dibenzothiophen-1-yl-5-(4-naphthalen-1-ylphenyl)phenyl]-3-phenylprop-2-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\C=C\c1ccccc1)c1cc(-c2ccc(-c3cccc4ccccc34)cc2)cc(-c2cccc3sc4ccccc4c23)c1)c1ccccc1 |
| InChI | InChI=1S/C50H34N2S/c51-50(38-16-5-2-6-17-38)52-46(30-25-34-13-3-1-4-14-34)41-32-39(35-26-28-37(29-27-35)43-21-11-18-36-15-7-8-19-42(36)43)31-40(33-41)44-22-12-24-48-49(44)45-20-9-10-23-47(45)53-48/h1-33,51H/b30-25+,51-50+,52-46+ |
| InChIKey | BUARNGSBSOBTOR-BOBBRJHHSA-N |
| XLogP | 13.74 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.90 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|