C40H29N3 — CID 143316965
N-[anilino-(4-naphthalen-1-ylphenyl)methylidene]-4-naphthalen-1-ylbenzenecarboximidamide (PubChem CID 143316965) has the molecular formula C40H29N3 and a molecular weight of 551.69 g/mol. Its IUPAC name is N-[anilino-(4-naphthalen-1-ylphenyl)methylidene]-4-naphthalen-1-ylbenzenecarboximidamide.
| Compound Name | N-[anilino-(4-naphthalen-1-ylphenyl)methylidene]-4-naphthalen-1-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143316965 |
| Molecular Formula | C40H29N3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[anilino-(4-naphthalen-1-ylphenyl)methylidene]-4-naphthalen-1-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/Nc1ccccc1)c1ccc(-c2cccc3ccccc23)cc1)c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C40H29N3/c41-39(32-24-20-30(21-25-32)37-18-8-12-28-10-4-6-16-35(28)37)43-40(42-34-14-2-1-3-15-34)33-26-22-31(23-27-33)38-19-9-13-29-11-5-7-17-36(29)38/h1-27H,(H2,41,42,43) |
| InChIKey | GORZIWRTJOQAJL-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|