C34H24N2 — CID 129256978
1,2-bis(4-naphthalen-1-ylphenyl)ethane-1,2-diimine (PubChem CID 129256978) has the molecular formula C34H24N2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1,2-bis(4-naphthalen-1-ylphenyl)ethane-1,2-diimine.
| Compound Name | 1,2-bis(4-naphthalen-1-ylphenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 129256978 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1,2-bis(4-naphthalen-1-ylphenyl)ethane-1,2-diimine |
| SMILES | [H]/N=C(C(=N/[H])/c1ccc(-c2cccc3ccccc23)cc1)\c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C34H24N2/c35-33(27-19-15-25(16-20-27)31-13-5-9-23-7-1-3-11-29(23)31)34(36)28-21-17-26(18-22-28)32-14-6-10-24-8-2-4-12-30(24)32/h1-22,35-36H/b35-33+,36-34+ |
| InChIKey | SAYVIJDACJXMGA-LBYUQGKWSA-N |
| XLogP | 8.76 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|