C26H24 — CID 153369031
9,9-dimethyl-2-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene (PubChem CID 153369031) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is 9,9-dimethyl-2-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene.
| Compound Name | 9,9-dimethyl-2-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene |
|---|---|
| PubChem CID | 153369031 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 9,9-dimethyl-2-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene |
| SMILES | C=C(/C=C\C)c1cccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1 |
| InChI | InChI=1S/C26H24/c1-5-9-18(2)19-10-8-11-20(16-19)21-14-15-23-22-12-6-7-13-24(22)26(3,4)25(23)17-21/h5-17H,2H2,1,3-4H3/b9-5- |
| InChIKey | VXLJTGQLWARZEH-UITAMQMPSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|