C39H34 — CID 153368874
9,9-dimethyl-1-[2-(3-methyl-5-phenylphenyl)-4-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene (PubChem CID 153368874) has the molecular formula C39H34 and a molecular weight of 502.70 g/mol. Its IUPAC name is 9,9-dimethyl-1-[2-(3-methyl-5-phenylphenyl)-4-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene.
| Compound Name | 9,9-dimethyl-1-[2-(3-methyl-5-phenylphenyl)-4-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene |
|---|---|
| PubChem CID | 153368874 |
| Molecular Formula | C39H34 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 9,9-dimethyl-1-[2-(3-methyl-5-phenylphenyl)-4-[(3Z)-penta-1,3-dien-2-yl]phenyl]fluorene |
| SMILES | C=C(/C=C\C)c1ccc(-c2cccc3c2C(C)(C)c2ccccc2-3)c(-c2cc(C)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C39H34/c1-6-13-27(3)29-20-21-32(34-17-12-18-35-33-16-10-11-19-37(33)39(4,5)38(34)35)36(25-29)31-23-26(2)22-30(24-31)28-14-8-7-9-15-28/h6-25H,3H2,1-2,4-5H3/b13-6- |
| InChIKey | VHNUOIZWPAKNQI-MLPAPPSSSA-N |
| XLogP | 10.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|