C34H36 — CID 153369703
2-ethenyl-1,1-dimethyl-5-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-3-[(Z)-prop-1-enyl]indene;toluene (PubChem CID 153369703) has the molecular formula C34H36 and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-ethenyl-1,1-dimethyl-5-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-3-[(Z)-prop-1-enyl]indene;toluene.
| Compound Name | 2-ethenyl-1,1-dimethyl-5-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-3-[(Z)-prop-1-enyl]indene;toluene |
|---|---|
| PubChem CID | 153369703 |
| Molecular Formula | C34H36 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 2-ethenyl-1,1-dimethyl-5-[3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-3-[(Z)-prop-1-enyl]indene;toluene |
| SMILES | C=CC1=C(/C=C\C)c2cc(-c3cccc(C(=C)/C=C\C)c3)ccc2C1(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C27H28.C7H8/c1-7-11-19(4)20-13-10-14-21(17-20)22-15-16-26-24(18-22)23(12-8-2)25(9-3)27(26,5)6;1-7-5-3-2-4-6-7/h7-18H,3-4H2,1-2,5-6H3;2-6H,1H3/b11-7-,12-8-; |
| InChIKey | AQKQDIIVLXBVEC-AFGGWQTNSA-N |
| XLogP | 9.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|