C43H37N3 — CID 145110857
2-[3-[3-[2-ethenyl-1,1-dimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]phenyl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 145110857) has the molecular formula C43H37N3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 2-[3-[3-[2-ethenyl-1,1-dimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]phenyl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[3-[3-[2-ethenyl-1,1-dimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]phenyl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 145110857 |
| Molecular Formula | C43H37N3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 2-[3-[3-[2-ethenyl-1,1-dimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]phenyl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C=CC1=C(/C=C\C)c2cc(-c3cccc(-c4cccc(C5=NC(c6ccccc6)N=C(c6ccccc6)N5)c4)c3)ccc2C1(C)C |
| InChI | InChI=1S/C43H37N3/c1-5-15-36-37-28-34(24-25-39(37)43(3,4)38(36)6-2)32-21-13-20-31(26-32)33-22-14-23-35(27-33)42-45-40(29-16-9-7-10-17-29)44-41(46-42)30-18-11-8-12-19-30/h5-28,40H,2H2,1,3-4H3,(H,44,45,46)/b15-5- |
| InChIKey | IGUHIVNGQJZONC-WCSRMQSCSA-N |
| XLogP | 10.32 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |