C39H29N3 — CID 118543950
2,4,6-tris(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 118543950) has the molecular formula C39H29N3 and a molecular weight of 539.68 g/mol. Its IUPAC name is 2,4,6-tris(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 118543950 |
| Molecular Formula | C39H29N3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2,4,6-tris(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(C3=NC(c4cccc(-c5ccccc5)c4)N=C(c4cccc(-c5ccccc5)c4)N3)c2)cc1 |
| InChI | InChI=1S/C39H29N3/c1-4-13-28(14-5-1)31-19-10-22-34(25-31)37-40-38(35-23-11-20-32(26-35)29-15-6-2-7-16-29)42-39(41-37)36-24-12-21-33(27-36)30-17-8-3-9-18-30/h1-27,37H,(H,40,41,42) |
| InChIKey | KFFKVQXSIJCHPT-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |