C52H37N3 — CID 139400710
4-[3-[3-(9,9-diphenylfluoren-2-yl)phenyl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 139400710) has the molecular formula C52H37N3 and a molecular weight of 703.89 g/mol. Its IUPAC name is 4-[3-[3-(9,9-diphenylfluoren-2-yl)phenyl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[3-[3-(9,9-diphenylfluoren-2-yl)phenyl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 139400710 |
| Molecular Formula | C52H37N3 |
| Molecular Weight | 703.89 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | 4-[3-[3-(9,9-diphenylfluoren-2-yl)phenyl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3cccc(-c4cccc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)c4)c3)N=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C52H37N3/c1-5-17-36(18-6-1)49-53-50(37-19-7-2-8-20-37)55-51(54-49)42-24-16-23-40(34-42)38-21-15-22-39(33-38)41-31-32-46-45-29-13-14-30-47(45)52(48(46)35-41,43-25-9-3-10-26-43)44-27-11-4-12-28-44/h1-35,51H,(H,53,54,55) |
| InChIKey | MNWKROGKYDEAPU-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.89 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |