C32H24N4 — CID 164758282
2,6-diphenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 164758282) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2,6-diphenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,6-diphenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 164758282 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2,6-diphenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3cc(-c4ccccc4)cc(-c4ccncc4)c3)N=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C32H24N4/c1-4-10-23(11-5-1)27-20-28(24-16-18-33-19-17-24)22-29(21-27)32-35-30(25-12-6-2-7-13-25)34-31(36-32)26-14-8-3-9-15-26/h1-22,32H,(H,34,35,36) |
| InChIKey | NTHGFEWCWZHMTQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |