C55H39N5 — CID 153197016
2-phenyl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,4-dihydro-1,3,5-triazine (PubChem CID 153197016) has the molecular formula C55H39N5 and a molecular weight of 769.95 g/mol. Its IUPAC name is 2-phenyl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-phenyl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 153197016 |
| Molecular Formula | C55H39N5 |
| Molecular Weight | 769.95 g/mol |
| Exact Mass | 769.32 |
| IUPAC Name | 2-phenyl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3cc(-c4ccccc4)cc(-c4ccc(-c5ccccn5)cc4)c3)N=C(c3cc(-c4ccccc4)cc(-c4ccc(-c5ccccn5)cc4)c3)N2)cc1 |
| InChI | InChI=1S/C55H39N5/c1-4-14-38(15-5-1)45-32-47(40-22-26-42(27-23-40)51-20-10-12-30-56-51)36-49(34-45)54-58-53(44-18-8-3-9-19-44)59-55(60-54)50-35-46(39-16-6-2-7-17-39)33-48(37-50)41-24-28-43(29-25-41)52-21-11-13-31-57-52/h1-37,54H,(H,58,59,60) |
| InChIKey | WJEDTTPAKAWJFM-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.95 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |