C32H27N3 — CID 118642062
2,6-diphenyl-4-[3-[(1E,4E)-5-phenylpenta-1,4-dienyl]phenyl]-1,4-dihydro-1,3,5-triazine (PubChem CID 118642062) has the molecular formula C32H27N3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2,6-diphenyl-4-[3-[(1E,4E)-5-phenylpenta-1,4-dienyl]phenyl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,6-diphenyl-4-[3-[(1E,4E)-5-phenylpenta-1,4-dienyl]phenyl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 118642062 |
| Molecular Formula | C32H27N3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2,6-diphenyl-4-[3-[(1E,4E)-5-phenylpenta-1,4-dienyl]phenyl]-1,4-dihydro-1,3,5-triazine |
| SMILES | C(=C/c1ccccc1)\C/C=C/c1cccc(C2N=C(c3ccccc3)NC(c3ccccc3)=N2)c1 |
| InChI | InChI=1S/C32H27N3/c1-5-14-25(15-6-1)16-7-2-8-17-26-18-13-23-29(24-26)32-34-30(27-19-9-3-10-20-27)33-31(35-32)28-21-11-4-12-22-28/h1,3-24,32H,2H2,(H,33,34,35)/b16-7+,17-8+ |
| InChIKey | KRXGNAUAMOQRPI-GDWCLCACSA-N |
| XLogP | 7.30 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |