C21H16BrN3 — CID 126727956
2-(2-bromophenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 126727956) has the molecular formula C21H16BrN3 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(2-bromophenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126727956 |
| Molecular Formula | C21H16BrN3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-(2-bromophenyl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | Brc1ccccc1C1=NC(c2ccccc2)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C21H16BrN3/c22-18-14-8-7-13-17(18)21-24-19(15-9-3-1-4-10-15)23-20(25-21)16-11-5-2-6-12-16/h1-14,19H,(H,23,24,25) |
| InChIKey | MDMDLJOBKJNYPG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |