C16H13BrN2 — CID 123546607
6-bromo-2,4-diphenyl-1,4-dihydropyrimidine (PubChem CID 123546607) has the molecular formula C16H13BrN2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 6-bromo-2,4-diphenyl-1,4-dihydropyrimidine.
| Compound Name | 6-bromo-2,4-diphenyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123546607 |
| Molecular Formula | C16H13BrN2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 6-bromo-2,4-diphenyl-1,4-dihydropyrimidine |
| SMILES | BrC1=CC(c2ccccc2)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C16H13BrN2/c17-15-11-14(12-7-3-1-4-8-12)18-16(19-15)13-9-5-2-6-10-13/h1-11,14H,(H,18,19) |
| InChIKey | OPPJNKWBYXWCFV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|