C31H36N2 — CID 167210755
N'-[1-[2-ethenyl-3,3-dimethyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-N-(3-methylpentan-2-ylidene)benzenecarboximidamide (PubChem CID 167210755) has the molecular formula C31H36N2 and a molecular weight of 436.64 g/mol. Its IUPAC name is N'-[1-[2-ethenyl-3,3-dimethyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-N-(3-methylpentan-2-ylidene)benzenecarboximidamide.
| Compound Name | N'-[1-[2-ethenyl-3,3-dimethyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-N-(3-methylpentan-2-ylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 167210755 |
| Molecular Formula | C31H36N2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | N'-[1-[2-ethenyl-3,3-dimethyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-N-(3-methylpentan-2-ylidene)benzenecarboximidamide |
| SMILES | C=CC1=C(/C=C\C)c2ccc(C(=C)/N=C(\N=C(/C)C(C)CC)c3ccccc3)cc2C1(C)C |
| InChI | InChI=1S/C31H36N2/c1-9-15-26-27-19-18-25(20-29(27)31(7,8)28(26)11-3)23(6)33-30(24-16-13-12-14-17-24)32-22(5)21(4)10-2/h9,11-21H,3,6,10H2,1-2,4-5,7-8H3/b15-9-,32-22+,33-30- |
| InChIKey | VSLAWILFHBILQD-ADOKQTCSSA-N |
| XLogP | 8.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|