C53H40N2 — CID 170118544
N'-(1-phenylethenyl)-N-(1-phenylethylidene)-4-(2,3,4,5-tetraphenylphenyl)benzenecarboximidamide (PubChem CID 170118544) has the molecular formula C53H40N2 and a molecular weight of 704.92 g/mol. Its IUPAC name is N'-(1-phenylethenyl)-N-(1-phenylethylidene)-4-(2,3,4,5-tetraphenylphenyl)benzenecarboximidamide.
| Compound Name | N'-(1-phenylethenyl)-N-(1-phenylethylidene)-4-(2,3,4,5-tetraphenylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 170118544 |
| Molecular Formula | C53H40N2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | N'-(1-phenylethenyl)-N-(1-phenylethylidene)-4-(2,3,4,5-tetraphenylphenyl)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C53H40N2/c1-38(40-21-9-3-10-22-40)54-53(55-39(2)41-23-11-4-12-24-41)47-35-33-43(34-36-47)49-37-48(42-25-13-5-14-26-42)50(44-27-15-6-16-28-44)52(46-31-19-8-20-32-46)51(49)45-29-17-7-18-30-45/h3-37H,1H2,2H3/b54-53-,55-39+ |
| InChIKey | HUXXPWABLUJOLI-DIFBKGAUSA-N |
| XLogP | 13.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|