C47H32N2O3S — CID 169131863
9-(5,5-dioxodibenzothiophen-2-yl)-N'-(1-phenylethenyl)-N-[1-(4-phenylphenyl)ethylidene]dibenzofuran-1-carboximidamide (PubChem CID 169131863) has the molecular formula C47H32N2O3S and a molecular weight of 704.85 g/mol. Its IUPAC name is 9-(5,5-dioxodibenzothiophen-2-yl)-N'-(1-phenylethenyl)-N-[1-(4-phenylphenyl)ethylidene]dibenzofuran-1-carboximidamide.
| Compound Name | 9-(5,5-dioxodibenzothiophen-2-yl)-N'-(1-phenylethenyl)-N-[1-(4-phenylphenyl)ethylidene]dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 169131863 |
| Molecular Formula | C47H32N2O3S |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.21 |
| IUPAC Name | 9-(5,5-dioxodibenzothiophen-2-yl)-N'-(1-phenylethenyl)-N-[1-(4-phenylphenyl)ethylidene]dibenzofuran-1-carboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccc(-c2ccccc2)cc1)c1cccc2oc3cccc(-c4ccc5c(c4)-c4ccccc4S5(=O)=O)c3c12)c1ccccc1 |
| InChI | InChI=1S/C47H32N2O3S/c1-30(32-13-5-3-6-14-32)48-47(49-31(2)33-23-25-35(26-24-33)34-15-7-4-8-16-34)39-19-12-21-42-46(39)45-37(18-11-20-41(45)52-42)36-27-28-44-40(29-36)38-17-9-10-22-43(38)53(44,50)51/h3-29H,1H2,2H3/b48-47-,49-31+ |
| InChIKey | UYSNEFBXVFNOGF-JFQVSRCZSA-N |
| XLogP | 11.66 |
| TPSA | 72.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|