C30H24N2O — CID 145007215
N'-[1-(8-methyldibenzofuran-1-yl)ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 145007215) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is N'-[1-(8-methyldibenzofuran-1-yl)ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[1-(8-methyldibenzofuran-1-yl)ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 145007215 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N'-[1-(8-methyldibenzofuran-1-yl)ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccccc1)c1cccc2oc3ccc(C)cc3c12 |
| InChI | InChI=1S/C30H24N2O/c1-20-17-18-27-26(19-20)29-25(15-10-16-28(29)33-27)22(3)32-30(24-13-8-5-9-14-24)31-21(2)23-11-6-4-7-12-23/h4-19H,3H2,1-2H3/b31-21+,32-30- |
| InChIKey | IIWFSDAYYNOKBN-BGGBNECNSA-N |
| XLogP | 7.82 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|