C47H32N2OS — CID 163590140
N-(1-dibenzofuran-3-ylethylidene)-N'-(1-phenylethenyl)-8-(3-phenylphenyl)dibenzothiophene-1-carboximidamide (PubChem CID 163590140) has the molecular formula C47H32N2OS and a molecular weight of 672.85 g/mol. Its IUPAC name is N-(1-dibenzofuran-3-ylethylidene)-N'-(1-phenylethenyl)-8-(3-phenylphenyl)dibenzothiophene-1-carboximidamide.
| Compound Name | N-(1-dibenzofuran-3-ylethylidene)-N'-(1-phenylethenyl)-8-(3-phenylphenyl)dibenzothiophene-1-carboximidamide |
|---|---|
| PubChem CID | 163590140 |
| Molecular Formula | C47H32N2OS |
| Molecular Weight | 672.85 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | N-(1-dibenzofuran-3-ylethylidene)-N'-(1-phenylethenyl)-8-(3-phenylphenyl)dibenzothiophene-1-carboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccc2c(c1)oc1ccccc12)c1cccc2sc3ccc(-c4cccc(-c5ccccc5)c4)cc3c12)c1ccccc1 |
| InChI | InChI=1S/C47H32N2OS/c1-30(32-13-5-3-6-14-32)48-47(49-31(2)34-23-25-39-38-19-9-10-21-42(38)50-43(39)29-34)40-20-12-22-45-46(40)41-28-37(24-26-44(41)51-45)36-18-11-17-35(27-36)33-15-7-4-8-16-33/h3-29H,1H2,2H3/b48-47-,49-31+ |
| InChIKey | GOVMKZCGKISRIJ-JFQVSRCZSA-N |
| XLogP | 13.21 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.85 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|